C11H13F3N2O — CID 102709143
2-(cyclopropylamino)-1-[4-(trifluoromethyl)-3-pyridinyl]ethanol (PubChem CID 102709143) has the molecular formula C11H13F3N2O and a molecular weight of 246.23 g/mol. Its IUPAC name is 2-(cyclopropylamino)-1-[4-(trifluoromethyl)-3-pyridinyl]ethanol.
| Compound Name | 2-(cyclopropylamino)-1-[4-(trifluoromethyl)-3-pyridinyl]ethanol |
|---|---|
| PubChem CID | 102709143 |
| Molecular Formula | C11H13F3N2O |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 2-(cyclopropylamino)-1-[4-(trifluoromethyl)-3-pyridinyl]ethanol |
| SMILES | OC(CNC1CC1)c1cnccc1C(F)(F)F |
| InChI | InChI=1S/C11H13F3N2O/c12-11(13,14)9-3-4-15-5-8(9)10(17)6-16-7-1-2-7/h3-5,7,10,16-17H,1-2,6H2 |
| InChIKey | BMNIWELIPRWMDW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |