C19H17ClFNO4 — CID 10270961
4-[(2-chlorophenyl)methyl-[2-(4-fluorophenyl)ethyl]amino]-2,4-dioxobutanoic acid (PubChem CID 10270961) has the molecular formula C19H17ClFNO4 and a molecular weight of 377.80 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methyl-[2-(4-fluorophenyl)ethyl]amino]-2,4-dioxobutanoic acid.
| Compound Name | 4-[(2-chlorophenyl)methyl-[2-(4-fluorophenyl)ethyl]amino]-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 10270961 |
| Molecular Formula | C19H17ClFNO4 |
| Molecular Weight | 377.80 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 4-[(2-chlorophenyl)methyl-[2-(4-fluorophenyl)ethyl]amino]-2,4-dioxobutanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)N(CCc1ccc(F)cc1)Cc1ccccc1Cl |
| InChI | InChI=1S/C19H17ClFNO4/c20-16-4-2-1-3-14(16)12-22(18(24)11-17(23)19(25)26)10-9-13-5-7-15(21)8-6-13/h1-8H,9-12H2,(H,25,26) |
| InChIKey | MQQZEKFMIBSAKW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.80 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|