C14H20F6N2O3 — CID 10270978
N-heptan-2-yl-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,5-dihydro-1,2-oxazole-3-carboxamide (PubChem CID 10270978) has the molecular formula C14H20F6N2O3 and a molecular weight of 378.31 g/mol. Its IUPAC name is N-heptan-2-yl-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,5-dihydro-1,2-oxazole-3-carboxamide.
| Compound Name | N-heptan-2-yl-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,5-dihydro-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 10270978 |
| Molecular Formula | C14H20F6N2O3 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N-heptan-2-yl-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,5-dihydro-1,2-oxazole-3-carboxamide |
| SMILES | CCCCCC(C)NC(=O)C1=NOC(C(O)(C(F)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C14H20F6N2O3/c1-3-4-5-6-8(2)21-11(23)9-7-10(25-22-9)12(24,13(15,16)17)14(18,19)20/h8,10,24H,3-7H2,1-2H3,(H,21,23) |
| InChIKey | JIKHYYKSXSXRDY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|