C12H12F2N4OS — CID 102709910
2,3-difluoro-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]pyridine-4-carboxamide (PubChem CID 102709910) has the molecular formula C12H12F2N4OS and a molecular weight of 298.32 g/mol. Its IUPAC name is 2,3-difluoro-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]pyridine-4-carboxamide.
| Compound Name | 2,3-difluoro-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 102709910 |
| Molecular Formula | C12H12F2N4OS |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 2,3-difluoro-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]pyridine-4-carboxamide |
| SMILES | CC(C)Cc1nnc(NC(=O)c2ccnc(F)c2F)s1 |
| InChI | InChI=1S/C12H12F2N4OS/c1-6(2)5-8-17-18-12(20-8)16-11(19)7-3-4-15-10(14)9(7)13/h3-4,6H,5H2,1-2H3,(H,16,18,19) |
| InChIKey | HZIOEUNGQBZBHH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|