C11H15F3N2O2S — CID 102710024
N-methyl-2-methylsulfonyl-1-[4-(trifluoromethyl)-3-pyridinyl]propan-1-amine (PubChem CID 102710024) has the molecular formula C11H15F3N2O2S and a molecular weight of 296.31 g/mol. Its IUPAC name is N-methyl-2-methylsulfonyl-1-[4-(trifluoromethyl)-3-pyridinyl]propan-1-amine.
| Compound Name | N-methyl-2-methylsulfonyl-1-[4-(trifluoromethyl)-3-pyridinyl]propan-1-amine |
|---|---|
| PubChem CID | 102710024 |
| Molecular Formula | C11H15F3N2O2S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | N-methyl-2-methylsulfonyl-1-[4-(trifluoromethyl)-3-pyridinyl]propan-1-amine |
| SMILES | CNC(c1cnccc1C(F)(F)F)C(C)S(C)(=O)=O |
| InChI | InChI=1S/C11H15F3N2O2S/c1-7(19(3,17)18)10(15-2)8-6-16-5-4-9(8)11(12,13)14/h4-7,10,15H,1-3H3 |
| InChIKey | MHXKQANPZNFQEE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |