C14H14N2O4 — CID 102711165
2-oxo-1-[2-oxo-2-(prop-2-enylamino)ethyl]-3H-indole-5-carboxylic acid (PubChem CID 102711165) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 2-oxo-1-[2-oxo-2-(prop-2-enylamino)ethyl]-3H-indole-5-carboxylic acid.
| Compound Name | 2-oxo-1-[2-oxo-2-(prop-2-enylamino)ethyl]-3H-indole-5-carboxylic acid |
|---|---|
| PubChem CID | 102711165 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 2-oxo-1-[2-oxo-2-(prop-2-enylamino)ethyl]-3H-indole-5-carboxylic acid |
| SMILES | C=CCNC(=O)CN1C(=O)Cc2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C14H14N2O4/c1-2-5-15-12(17)8-16-11-4-3-9(14(19)20)6-10(11)7-13(16)18/h2-4,6H,1,5,7-8H2,(H,15,17)(H,19,20) |
| InChIKey | CJTAGMKWJZYPFO-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|