C15H16N2O3 — CID 102711347
1-(4-cyanobutyl)-2-oxo-3,4-dihydroquinoline-6-carboxylic acid (PubChem CID 102711347) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is 1-(4-cyanobutyl)-2-oxo-3,4-dihydroquinoline-6-carboxylic acid.
| Compound Name | 1-(4-cyanobutyl)-2-oxo-3,4-dihydroquinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 102711347 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 1-(4-cyanobutyl)-2-oxo-3,4-dihydroquinoline-6-carboxylic acid |
| SMILES | N#CCCCCN1C(=O)CCc2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C15H16N2O3/c16-8-2-1-3-9-17-13-6-4-12(15(19)20)10-11(13)5-7-14(17)18/h4,6,10H,1-3,5,7,9H2,(H,19,20) |
| InChIKey | QVJGACNNMRYXKZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|