C16H13FN2O2 — CID 102711893
N-[(2-fluorophenyl)methyl]-2-oxo-1,3-dihydroindole-6-carboxamide (PubChem CID 102711893) has the molecular formula C16H13FN2O2 and a molecular weight of 284.29 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-2-oxo-1,3-dihydroindole-6-carboxamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-2-oxo-1,3-dihydroindole-6-carboxamide |
|---|---|
| PubChem CID | 102711893 |
| Molecular Formula | C16H13FN2O2 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-2-oxo-1,3-dihydroindole-6-carboxamide |
| SMILES | O=C1Cc2ccc(C(=O)NCc3ccccc3F)cc2N1 |
| InChI | InChI=1S/C16H13FN2O2/c17-13-4-2-1-3-12(13)9-18-16(21)11-6-5-10-8-15(20)19-14(10)7-11/h1-7H,8-9H2,(H,18,21)(H,19,20) |
| InChIKey | DXHYWUISAZBWTD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |