C14H18N2O3 — CID 102712770
N-(3-hydroxybutyl)-N-methyl-2-oxo-1,3-dihydroindole-6-carboxamide (PubChem CID 102712770) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is N-(3-hydroxybutyl)-N-methyl-2-oxo-1,3-dihydroindole-6-carboxamide.
| Compound Name | N-(3-hydroxybutyl)-N-methyl-2-oxo-1,3-dihydroindole-6-carboxamide |
|---|---|
| PubChem CID | 102712770 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-(3-hydroxybutyl)-N-methyl-2-oxo-1,3-dihydroindole-6-carboxamide |
| SMILES | CC(O)CCN(C)C(=O)c1ccc2c(c1)NC(=O)C2 |
| InChI | InChI=1S/C14H18N2O3/c1-9(17)5-6-16(2)14(19)11-4-3-10-8-13(18)15-12(10)7-11/h3-4,7,9,17H,5-6,8H2,1-2H3,(H,15,18) |
| InChIKey | DPBSBBAWMNLQCS-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |