C16H22N4O — CID 102713102
2-[(8-amino-3-methylisoquinolin-5-yl)-ethylamino]-N,N-dimethylacetamide (PubChem CID 102713102) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is 2-[(8-amino-3-methylisoquinolin-5-yl)-ethylamino]-N,N-dimethylacetamide.
| Compound Name | 2-[(8-amino-3-methylisoquinolin-5-yl)-ethylamino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 102713102 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 2-[(8-amino-3-methylisoquinolin-5-yl)-ethylamino]-N,N-dimethylacetamide |
| SMILES | CCN(CC(=O)N(C)C)c1ccc(N)c2cnc(C)cc12 |
| InChI | InChI=1S/C16H22N4O/c1-5-20(10-16(21)19(3)4)15-7-6-14(17)13-9-18-11(2)8-12(13)15/h6-9H,5,10,17H2,1-4H3 |
| InChIKey | ULZXDCKMFCZQFR-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|