C17H19N3S — CID 102713195
3-methyl-5-N-[1-(5-methylthiophen-2-yl)ethyl]isoquinoline-5,8-diamine (PubChem CID 102713195) has the molecular formula C17H19N3S and a molecular weight of 297.43 g/mol. Its IUPAC name is 3-methyl-5-N-[1-(5-methylthiophen-2-yl)ethyl]isoquinoline-5,8-diamine.
| Compound Name | 3-methyl-5-N-[1-(5-methylthiophen-2-yl)ethyl]isoquinoline-5,8-diamine |
|---|---|
| PubChem CID | 102713195 |
| Molecular Formula | C17H19N3S |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 3-methyl-5-N-[1-(5-methylthiophen-2-yl)ethyl]isoquinoline-5,8-diamine |
| SMILES | Cc1cc2c(NC(C)c3ccc(C)s3)ccc(N)c2cn1 |
| InChI | InChI=1S/C17H19N3S/c1-10-8-13-14(9-19-10)15(18)5-6-16(13)20-12(3)17-7-4-11(2)21-17/h4-9,12,20H,18H2,1-3H3 |
| InChIKey | XIHUFYQHESJCCD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|