C16H21N3S — CID 102713684
5-(2,3-dimethylthiomorpholin-4-yl)-3-methylisoquinolin-8-amine (PubChem CID 102713684) has the molecular formula C16H21N3S and a molecular weight of 287.43 g/mol. Its IUPAC name is 5-(2,3-dimethylthiomorpholin-4-yl)-3-methylisoquinolin-8-amine.
| Compound Name | 5-(2,3-dimethylthiomorpholin-4-yl)-3-methylisoquinolin-8-amine |
|---|---|
| PubChem CID | 102713684 |
| Molecular Formula | C16H21N3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 5-(2,3-dimethylthiomorpholin-4-yl)-3-methylisoquinolin-8-amine |
| SMILES | Cc1cc2c(N3CCSC(C)C3C)ccc(N)c2cn1 |
| InChI | InChI=1S/C16H21N3S/c1-10-8-13-14(9-18-10)15(17)4-5-16(13)19-6-7-20-12(3)11(19)2/h4-5,8-9,11-12H,6-7,17H2,1-3H3 |
| InChIKey | XMDZCRZZTUIZBC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|