C13H17BrF3NO3 — CID 102714329
4-[3-bromo-4-(trifluoromethoxy)phenoxy]-2-ethoxybutan-1-amine (PubChem CID 102714329) has the molecular formula C13H17BrF3NO3 and a molecular weight of 372.18 g/mol. Its IUPAC name is 4-[3-bromo-4-(trifluoromethoxy)phenoxy]-2-ethoxybutan-1-amine.
| Compound Name | 4-[3-bromo-4-(trifluoromethoxy)phenoxy]-2-ethoxybutan-1-amine |
|---|---|
| PubChem CID | 102714329 |
| Molecular Formula | C13H17BrF3NO3 |
| Molecular Weight | 372.18 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | 4-[3-bromo-4-(trifluoromethoxy)phenoxy]-2-ethoxybutan-1-amine |
| SMILES | CCOC(CN)CCOc1ccc(OC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C13H17BrF3NO3/c1-2-19-10(8-18)5-6-20-9-3-4-12(11(14)7-9)21-13(15,16)17/h3-4,7,10H,2,5-6,8,18H2,1H3 |
| InChIKey | ISNVFJAZZVQHJR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.18 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |