C14H17BrF3NO2 — CID 102715077
3-[3-bromo-4-(trifluoromethoxy)phenoxy]-2-ethyl-2-methylcyclobutan-1-amine (PubChem CID 102715077) has the molecular formula C14H17BrF3NO2 and a molecular weight of 368.19 g/mol. Its IUPAC name is 3-[3-bromo-4-(trifluoromethoxy)phenoxy]-2-ethyl-2-methylcyclobutan-1-amine.
| Compound Name | 3-[3-bromo-4-(trifluoromethoxy)phenoxy]-2-ethyl-2-methylcyclobutan-1-amine |
|---|---|
| PubChem CID | 102715077 |
| Molecular Formula | C14H17BrF3NO2 |
| Molecular Weight | 368.19 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 3-[3-bromo-4-(trifluoromethoxy)phenoxy]-2-ethyl-2-methylcyclobutan-1-amine |
| SMILES | CCC1(C)C(N)CC1Oc1ccc(OC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C14H17BrF3NO2/c1-3-13(2)11(19)7-12(13)20-8-4-5-10(9(15)6-8)21-14(16,17)18/h4-6,11-12H,3,7,19H2,1-2H3 |
| InChIKey | MGEGAPGRBUFSIW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.19 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |