C13H9ClF4N2 — CID 102715459
6-chloro-N-[(2-fluorophenyl)methyl]-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102715459) has the molecular formula C13H9ClF4N2 and a molecular weight of 304.67 g/mol. Its IUPAC name is 6-chloro-N-[(2-fluorophenyl)methyl]-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-chloro-N-[(2-fluorophenyl)methyl]-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102715459 |
| Molecular Formula | C13H9ClF4N2 |
| Molecular Weight | 304.67 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 6-chloro-N-[(2-fluorophenyl)methyl]-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | Fc1ccccc1CNc1cc(C(F)(F)F)cc(Cl)n1 |
| InChI | InChI=1S/C13H9ClF4N2/c14-11-5-9(13(16,17)18)6-12(20-11)19-7-8-3-1-2-4-10(8)15/h1-6H,7H2,(H,19,20) |
| InChIKey | AHNVDXNPLIEMPD-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.67 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|