C25H29N3O — CID 10271564
N-(cyanomethyl)-4-methyl-2-[3-[4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]phenyl]pentanamide (PubChem CID 10271564) has the molecular formula C25H29N3O and a molecular weight of 387.53 g/mol. Its IUPAC name is N-(cyanomethyl)-4-methyl-2-[3-[4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]phenyl]pentanamide.
| Compound Name | N-(cyanomethyl)-4-methyl-2-[3-[4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]phenyl]pentanamide |
|---|---|
| PubChem CID | 10271564 |
| Molecular Formula | C25H29N3O |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | N-(cyanomethyl)-4-methyl-2-[3-[4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]phenyl]pentanamide |
| SMILES | CC(C)CC(C(=O)NCC#N)c1cccc(-c2ccc(C3=CCNCC3)cc2)c1 |
| InChI | InChI=1S/C25H29N3O/c1-18(2)16-24(25(29)28-15-12-26)23-5-3-4-22(17-23)20-8-6-19(7-9-20)21-10-13-27-14-11-21/h3-10,17-18,24,27H,11,13-16H2,1-2H3,(H,28,29) |
| InChIKey | YMDHLHZVVIBPIA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|