C16H28N4O5S — CID 10271604
(3R)-6-cyclohexyl-N-hydroxy-3-[3-(methanesulfonamidomethyl)-1,2,4-oxadiazol-5-yl]hexanamide (PubChem CID 10271604) has the molecular formula C16H28N4O5S and a molecular weight of 388.49 g/mol. Its IUPAC name is (3R)-6-cyclohexyl-N-hydroxy-3-[3-(methanesulfonamidomethyl)-1,2,4-oxadiazol-5-yl]hexanamide.
| Compound Name | (3R)-6-cyclohexyl-N-hydroxy-3-[3-(methanesulfonamidomethyl)-1,2,4-oxadiazol-5-yl]hexanamide |
|---|---|
| PubChem CID | 10271604 |
| Molecular Formula | C16H28N4O5S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | (3R)-6-cyclohexyl-N-hydroxy-3-[3-(methanesulfonamidomethyl)-1,2,4-oxadiazol-5-yl]hexanamide |
| SMILES | CS(=O)(=O)NCc1noc([C@H](CCCC2CCCCC2)CC(=O)NO)n1 |
| InChI | InChI=1S/C16H28N4O5S/c1-26(23,24)17-11-14-18-16(25-20-14)13(10-15(21)19-22)9-5-8-12-6-3-2-4-7-12/h12-13,17,22H,2-11H2,1H3,(H,19,21)/t13-/m1/s1 |
| InChIKey | NEGPFWDWNNSJRQ-CYBMUJFWSA-N |
| XLogP | 1.85 |
| TPSA | 134.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|