C13H17ClF3N3 — CID 102716081
1-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-N,N,4-trimethylpyrrolidin-3-amine (PubChem CID 102716081) has the molecular formula C13H17ClF3N3 and a molecular weight of 307.75 g/mol. Its IUPAC name is 1-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-N,N,4-trimethylpyrrolidin-3-amine.
| Compound Name | 1-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-N,N,4-trimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 102716081 |
| Molecular Formula | C13H17ClF3N3 |
| Molecular Weight | 307.75 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 1-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-N,N,4-trimethylpyrrolidin-3-amine |
| SMILES | CC1CN(c2cc(C(F)(F)F)cc(Cl)n2)CC1N(C)C |
| InChI | InChI=1S/C13H17ClF3N3/c1-8-6-20(7-10(8)19(2)3)12-5-9(13(15,16)17)4-11(14)18-12/h4-5,8,10H,6-7H2,1-3H3 |
| InChIKey | UNWAFRSYGADRBI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.75 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|