C13H13F3N2O — CID 102716707
6-(furan-3-yl)-N-propyl-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102716707) has the molecular formula C13H13F3N2O and a molecular weight of 270.25 g/mol. Its IUPAC name is 6-(furan-3-yl)-N-propyl-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-(furan-3-yl)-N-propyl-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102716707 |
| Molecular Formula | C13H13F3N2O |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 6-(furan-3-yl)-N-propyl-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCCNc1cc(C(F)(F)F)cc(-c2ccoc2)n1 |
| InChI | InChI=1S/C13H13F3N2O/c1-2-4-17-12-7-10(13(14,15)16)6-11(18-12)9-3-5-19-8-9/h3,5-8H,2,4H2,1H3,(H,17,18) |
| InChIKey | PTJKHMRDLXNKAP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |