C20H21Cl2N3O — CID 10271673
1-[1-(4-amino-3-methylphenyl)-7,8-dichloro-4-methyl-4,5-dihydro-2,3-benzodiazepin-3-yl]propan-1-one (PubChem CID 10271673) has the molecular formula C20H21Cl2N3O and a molecular weight of 390.31 g/mol. Its IUPAC name is 1-[1-(4-amino-3-methylphenyl)-7,8-dichloro-4-methyl-4,5-dihydro-2,3-benzodiazepin-3-yl]propan-1-one.
| Compound Name | 1-[1-(4-amino-3-methylphenyl)-7,8-dichloro-4-methyl-4,5-dihydro-2,3-benzodiazepin-3-yl]propan-1-one |
|---|---|
| PubChem CID | 10271673 |
| Molecular Formula | C20H21Cl2N3O |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 1-[1-(4-amino-3-methylphenyl)-7,8-dichloro-4-methyl-4,5-dihydro-2,3-benzodiazepin-3-yl]propan-1-one |
| SMILES | CCC(=O)N1N=C(c2ccc(N)c(C)c2)c2cc(Cl)c(Cl)cc2CC1C |
| InChI | InChI=1S/C20H21Cl2N3O/c1-4-19(26)25-12(3)8-14-9-16(21)17(22)10-15(14)20(24-25)13-5-6-18(23)11(2)7-13/h5-7,9-10,12H,4,8,23H2,1-3H3 |
| InChIKey | DCCUEAJLLDVYDC-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|