C24H26N2O3 — CID 10271702
ethyl 17-methoxy-6-methyl-1,7-diazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),5,9,14(19),15,17-heptaene-5-carboxylate (PubChem CID 10271702) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is ethyl 17-methoxy-6-methyl-1,7-diazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),5,9,14(19),15,17-heptaene-5-carboxylate.
| Compound Name | ethyl 17-methoxy-6-methyl-1,7-diazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),5,9,14(19),15,17-heptaene-5-carboxylate |
|---|---|
| PubChem CID | 10271702 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | ethyl 17-methoxy-6-methyl-1,7-diazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),5,9,14(19),15,17-heptaene-5-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c2ccc3c(c12)CN1CCc2cc(OC)ccc2C1C3 |
| InChI | InChI=1S/C24H26N2O3/c1-4-29-24(27)22-14(2)25-20-8-5-15-12-21-18-7-6-17(28-3)11-16(18)9-10-26(21)13-19(15)23(20)22/h5-8,11,21,25H,4,9-10,12-13H2,1-3H3 |
| InChIKey | YNUFWZZFEPKZSH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |