C9H12F3N3 — CID 102717244
6-N-propan-2-yl-4-(trifluoromethyl)pyridine-2,6-diamine (PubChem CID 102717244) has the molecular formula C9H12F3N3 and a molecular weight of 219.21 g/mol. Its IUPAC name is 6-N-propan-2-yl-4-(trifluoromethyl)pyridine-2,6-diamine.
| Compound Name | 6-N-propan-2-yl-4-(trifluoromethyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 102717244 |
| Molecular Formula | C9H12F3N3 |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 6-N-propan-2-yl-4-(trifluoromethyl)pyridine-2,6-diamine |
| SMILES | CC(C)Nc1cc(C(F)(F)F)cc(N)n1 |
| InChI | InChI=1S/C9H12F3N3/c1-5(2)14-8-4-6(9(10,11)12)3-7(13)15-8/h3-5H,1-2H3,(H3,13,14,15) |
| InChIKey | JQZVVURERKGAGL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |