About 6-(1,1-dioxo-1,4-thiazinan-4-yl)-N-ethyl-4-(trifluoromethyl)pyridin-2-amine
6-(1,1-dioxo-1,4-thiazinan-4-yl)-N-ethyl-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102717613) has the molecular formula C12H16F3N3O2S
and a molecular weight of 323.34 g/mol. Its IUPAC name is 6-(1,1-dioxo-1,4-thiazinan-4-yl)-N-ethyl-4-(trifluoromethyl)pyridin-2-amine.
Molecular Properties
| Compound Name | 6-(1,1-dioxo-1,4-thiazinan-4-yl)-N-ethyl-4-(trifluoromethyl)pyridin-2-amine |
| PubChem CID | 102717613 |
| Molecular Formula | C12H16F3N3O2S |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 6-(1,1-dioxo-1,4-thiazinan-4-yl)-N-ethyl-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCNc1cc(C(F)(F)F)cc(N2CCS(=O)(=O)CC2)n1 |
| InChI | InChI=1S/C12H16F3N3O2S/c1-2-16-10-7-9(12(13,14)15)8-11(17-10)18-3-5-21(19,20)6-4-18/h7-8H,2-6H2,1H3,(H,16,17) |
| InChIKey | IUEAPKWOBSWEOX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(1,1-dioxo-1,4-thiazinan-4-yl)-N-ethyl-4-(trifluoromethyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,1-dioxo-1,4-thiazinan-4-yl)-N-ethyl-4-(trifluoromethyl)pyridin-2-amine?
The IUPAC name of 6-(1,1-dioxo-1,4-thiazinan-4-yl)-N-ethyl-4-(trifluoromethyl)pyridin-2-amine (CID 102717613) is 6-(1,1-dioxo-1,4-thiazinan-4-yl)-N-ethyl-4-(trifluoromethyl)pyridin-2-amine.
What is the SMILES notation for 6-(1,1-dioxo-1,4-thiazinan-4-yl)-N-ethyl-4-(trifluoromethyl)pyridin-2-amine?
The canonical SMILES for 6-(1,1-dioxo-1,4-thiazinan-4-yl)-N-ethyl-4-(trifluoromethyl)pyridin-2-amine is CCNc1cc(C(F)(F)F)cc(N2CCS(=O)(=O)CC2)n1.
What is the InChIKey of 6-(1,1-dioxo-1,4-thiazinan-4-yl)-N-ethyl-4-(trifluoromethyl)pyridin-2-amine?
The InChIKey is IUEAPKWOBSWEOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F3N3O2S/c1-2-16-10-7-9(12(13,14)15)8-11(17-10)18-3-5-21(19,20)6-4-18/h7-8H,2-6H2,1H3,(H,16,17).
What are the key properties of 6-(1,1-dioxo-1,4-thiazinan-4-yl)-N-ethyl-4-(trifluoromethyl)pyridin-2-amine?
6-(1,1-dioxo-1,4-thiazinan-4-yl)-N-ethyl-4-(trifluoromethyl)pyridin-2-amine has a molecular weight of 323.34 g/mol, XLogP of 1.77, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,1-dioxo-1,4-thiazinan-4-yl)-N-ethyl-4-(trifluoromethyl)pyridin-2-amine is sourced from PubChem (CID 102717613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).