C13H16F3N3O — CID 102718121
6-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102718121) has the molecular formula C13H16F3N3O and a molecular weight of 287.29 g/mol. Its IUPAC name is 6-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102718121 |
| Molecular Formula | C13H16F3N3O |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 6-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | Nc1cc(C(F)(F)F)cc(N2CCOC3CCCC32)n1 |
| InChI | InChI=1S/C13H16F3N3O/c14-13(15,16)8-6-11(17)18-12(7-8)19-4-5-20-10-3-1-2-9(10)19/h6-7,9-10H,1-5H2,(H2,17,18) |
| InChIKey | JHECIUNLCIBROF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |