C23H28N4S — CID 10271853
N-[[4-(1H-[1]benzothiolo[3,2-c]pyrazol-3-yl)phenyl]methyl]-N',N'-dimethylpentane-1,5-diamine (PubChem CID 10271853) has the molecular formula C23H28N4S and a molecular weight of 392.57 g/mol. Its IUPAC name is N-[[4-(1H-[1]benzothiolo[3,2-c]pyrazol-3-yl)phenyl]methyl]-N',N'-dimethylpentane-1,5-diamine.
| Compound Name | N-[[4-(1H-[1]benzothiolo[3,2-c]pyrazol-3-yl)phenyl]methyl]-N',N'-dimethylpentane-1,5-diamine |
|---|---|
| PubChem CID | 10271853 |
| Molecular Formula | C23H28N4S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | N-[[4-(1H-[1]benzothiolo[3,2-c]pyrazol-3-yl)phenyl]methyl]-N',N'-dimethylpentane-1,5-diamine |
| SMILES | CN(C)CCCCCNCc1ccc(-c2n[nH]c3c2sc2ccccc23)cc1 |
| InChI | InChI=1S/C23H28N4S/c1-27(2)15-7-3-6-14-24-16-17-10-12-18(13-11-17)21-23-22(26-25-21)19-8-4-5-9-20(19)28-23/h4-5,8-13,24H,3,6-7,14-16H2,1-2H3,(H,25,26) |
| InChIKey | HPSWDBKEHWKAGG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|