C22H29F2NO3 — CID 10271902
(2E,4E,6Z)-7-[3-(2,2-difluoroethoxy)-2,6-di(propan-2-yl)-4-pyridinyl]-3-methylocta-2,4,6-trienoic acid (PubChem CID 10271902) has the molecular formula C22H29F2NO3 and a molecular weight of 393.47 g/mol. Its IUPAC name is (2E,4E,6Z)-7-[3-(2,2-difluoroethoxy)-2,6-di(propan-2-yl)-4-pyridinyl]-3-methylocta-2,4,6-trienoic acid.
| Compound Name | (2E,4E,6Z)-7-[3-(2,2-difluoroethoxy)-2,6-di(propan-2-yl)-4-pyridinyl]-3-methylocta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 10271902 |
| Molecular Formula | C22H29F2NO3 |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | (2E,4E,6Z)-7-[3-(2,2-difluoroethoxy)-2,6-di(propan-2-yl)-4-pyridinyl]-3-methylocta-2,4,6-trienoic acid |
| SMILES | C/C(=C/C=C/C(C)=C/C(=O)O)c1cc(C(C)C)nc(C(C)C)c1OCC(F)F |
| InChI | InChI=1S/C22H29F2NO3/c1-13(2)18-11-17(16(6)9-7-8-15(5)10-20(26)27)22(28-12-19(23)24)21(25-18)14(3)4/h7-11,13-14,19H,12H2,1-6H3,(H,26,27)/b8-7+,15-10+,16-9- |
| InChIKey | SZQFIXJLAVAXGS-JVRNXYQUSA-N |
| XLogP | 5.96 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|