C13H17F3N2O2 — CID 102720096
6-(2,6-dimethyloxan-4-yl)oxy-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102720096) has the molecular formula C13H17F3N2O2 and a molecular weight of 290.29 g/mol. Its IUPAC name is 6-(2,6-dimethyloxan-4-yl)oxy-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-(2,6-dimethyloxan-4-yl)oxy-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102720096 |
| Molecular Formula | C13H17F3N2O2 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 6-(2,6-dimethyloxan-4-yl)oxy-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC1CC(Oc2cc(C(F)(F)F)cc(N)n2)CC(C)O1 |
| InChI | InChI=1S/C13H17F3N2O2/c1-7-3-10(4-8(2)19-7)20-12-6-9(13(14,15)16)5-11(17)18-12/h5-8,10H,3-4H2,1-2H3,(H2,17,18) |
| InChIKey | LVKFDNOYUQETLV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |