C12H16F3N5O — CID 102720736
4-[6-hydrazinyl-4-(trifluoromethyl)-2-pyridinyl]-3,3-dimethylpiperazin-2-one (PubChem CID 102720736) has the molecular formula C12H16F3N5O and a molecular weight of 303.29 g/mol. Its IUPAC name is 4-[6-hydrazinyl-4-(trifluoromethyl)-2-pyridinyl]-3,3-dimethylpiperazin-2-one.
| Compound Name | 4-[6-hydrazinyl-4-(trifluoromethyl)-2-pyridinyl]-3,3-dimethylpiperazin-2-one |
|---|---|
| PubChem CID | 102720736 |
| Molecular Formula | C12H16F3N5O |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 4-[6-hydrazinyl-4-(trifluoromethyl)-2-pyridinyl]-3,3-dimethylpiperazin-2-one |
| SMILES | CC1(C)C(=O)NCCN1c1cc(C(F)(F)F)cc(NN)n1 |
| InChI | InChI=1S/C12H16F3N5O/c1-11(2)10(21)17-3-4-20(11)9-6-7(12(13,14)15)5-8(18-9)19-16/h5-6H,3-4,16H2,1-2H3,(H,17,21)(H,18,19) |
| InChIKey | WGZSCFOQYUHEAU-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|