C13H13F3N4S — CID 102720959
[6-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-(trifluoromethyl)-2-pyridinyl]hydrazine (PubChem CID 102720959) has the molecular formula C13H13F3N4S and a molecular weight of 314.34 g/mol. Its IUPAC name is [6-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-(trifluoromethyl)-2-pyridinyl]hydrazine.
| Compound Name | [6-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-(trifluoromethyl)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 102720959 |
| Molecular Formula | C13H13F3N4S |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | [6-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-(trifluoromethyl)-2-pyridinyl]hydrazine |
| SMILES | NNc1cc(C(F)(F)F)cc(N2CCc3sccc3C2)n1 |
| InChI | InChI=1S/C13H13F3N4S/c14-13(15,16)9-5-11(19-17)18-12(6-9)20-3-1-10-8(7-20)2-4-21-10/h2,4-6H,1,3,7,17H2,(H,18,19) |
| InChIKey | UDJKISFNIDCKQJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|