C14H21F3N4 — CID 102721064
[6-(2-propylpiperidin-1-yl)-4-(trifluoromethyl)-2-pyridinyl]hydrazine (PubChem CID 102721064) has the molecular formula C14H21F3N4 and a molecular weight of 302.34 g/mol. Its IUPAC name is [6-(2-propylpiperidin-1-yl)-4-(trifluoromethyl)-2-pyridinyl]hydrazine.
| Compound Name | [6-(2-propylpiperidin-1-yl)-4-(trifluoromethyl)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 102721064 |
| Molecular Formula | C14H21F3N4 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | [6-(2-propylpiperidin-1-yl)-4-(trifluoromethyl)-2-pyridinyl]hydrazine |
| SMILES | CCCC1CCCCN1c1cc(C(F)(F)F)cc(NN)n1 |
| InChI | InChI=1S/C14H21F3N4/c1-2-5-11-6-3-4-7-21(11)13-9-10(14(15,16)17)8-12(19-13)20-18/h8-9,11H,2-7,18H2,1H3,(H,19,20) |
| InChIKey | OKVNYRCPRBUAIY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|