C10H7F6N3O — CID 102721658
2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3H-benzimidazol-5-amine (PubChem CID 102721658) has the molecular formula C10H7F6N3O and a molecular weight of 299.17 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3H-benzimidazol-5-amine.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 102721658 |
| Molecular Formula | C10H7F6N3O |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3H-benzimidazol-5-amine |
| SMILES | Nc1ccc2nc(OC(C(F)(F)F)C(F)(F)F)[nH]c2c1 |
| InChI | InChI=1S/C10H7F6N3O/c11-9(12,13)7(10(14,15)16)20-8-18-5-2-1-4(17)3-6(5)19-8/h1-3,7H,17H2,(H,18,19) |
| InChIKey | BGZGELAIOBJTQF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|