C11H12F6N2O2 — CID 102721710
5-amino-1-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propyl]pyridin-2-one (PubChem CID 102721710) has the molecular formula C11H12F6N2O2 and a molecular weight of 318.22 g/mol. Its IUPAC name is 5-amino-1-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propyl]pyridin-2-one.
| Compound Name | 5-amino-1-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propyl]pyridin-2-one |
|---|---|
| PubChem CID | 102721710 |
| Molecular Formula | C11H12F6N2O2 |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 5-amino-1-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propyl]pyridin-2-one |
| SMILES | Nc1ccc(=O)n(CCCOC(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H12F6N2O2/c12-10(13,14)9(11(15,16)17)21-5-1-4-19-6-7(18)2-3-8(19)20/h2-3,6,9H,1,4-5,18H2 |
| InChIKey | ANHCFIPFGYAZST-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|