C11H17F6NO2 — CID 102721860
3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-propyloxan-4-amine (PubChem CID 102721860) has the molecular formula C11H17F6NO2 and a molecular weight of 309.25 g/mol. Its IUPAC name is 3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-propyloxan-4-amine.
| Compound Name | 3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-propyloxan-4-amine |
|---|---|
| PubChem CID | 102721860 |
| Molecular Formula | C11H17F6NO2 |
| Molecular Weight | 309.25 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-propyloxan-4-amine |
| SMILES | CCCNC1CCOCC1OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H17F6NO2/c1-2-4-18-7-3-5-19-6-8(7)20-9(10(12,13)14)11(15,16)17/h7-9,18H,2-6H2,1H3 |
| InChIKey | OAFVRTNGCJMJEM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.25 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |