C10H15F6NO2 — CID 102721892
N-ethyl-3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)oxan-4-amine (PubChem CID 102721892) has the molecular formula C10H15F6NO2 and a molecular weight of 295.22 g/mol. Its IUPAC name is N-ethyl-3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)oxan-4-amine.
| Compound Name | N-ethyl-3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)oxan-4-amine |
|---|---|
| PubChem CID | 102721892 |
| Molecular Formula | C10H15F6NO2 |
| Molecular Weight | 295.22 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | N-ethyl-3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)oxan-4-amine |
| SMILES | CCNC1CCOCC1OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H15F6NO2/c1-2-17-6-3-4-18-5-7(6)19-8(9(11,12)13)10(14,15)16/h6-8,17H,2-5H2,1H3 |
| InChIKey | JNYWXQVWEHWXRY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.22 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |