C10H17F6NO2 — CID 102721906
3-amino-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4,4-dimethylpentan-1-ol (PubChem CID 102721906) has the molecular formula C10H17F6NO2 and a molecular weight of 297.24 g/mol. Its IUPAC name is 3-amino-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4,4-dimethylpentan-1-ol.
| Compound Name | 3-amino-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 102721906 |
| Molecular Formula | C10H17F6NO2 |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 3-amino-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4,4-dimethylpentan-1-ol |
| SMILES | CC(C)(C)C(N)C(CO)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H17F6NO2/c1-8(2,3)6(17)5(4-18)19-7(9(11,12)13)10(14,15)16/h5-7,18H,4,17H2,1-3H3 |
| InChIKey | MSAKWFVCYXFYCH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |