C9H15F6NO2 — CID 102721937
3-amino-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)hexan-1-ol (PubChem CID 102721937) has the molecular formula C9H15F6NO2 and a molecular weight of 283.21 g/mol. Its IUPAC name is 3-amino-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)hexan-1-ol.
| Compound Name | 3-amino-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)hexan-1-ol |
|---|---|
| PubChem CID | 102721937 |
| Molecular Formula | C9H15F6NO2 |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 3-amino-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)hexan-1-ol |
| SMILES | CCCC(N)C(CO)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H15F6NO2/c1-2-3-5(16)6(4-17)18-7(8(10,11)12)9(13,14)15/h5-7,17H,2-4,16H2,1H3 |
| InChIKey | FZOGXIBVIKXROA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |