C7H9BrF6O — CID 102722024
1-bromo-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)butane (PubChem CID 102722024) has the molecular formula C7H9BrF6O and a molecular weight of 303.04 g/mol. Its IUPAC name is 1-bromo-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)butane.
| Compound Name | 1-bromo-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)butane |
|---|---|
| PubChem CID | 102722024 |
| Molecular Formula | C7H9BrF6O |
| Molecular Weight | 303.04 g/mol |
| Exact Mass | 301.97 |
| IUPAC Name | 1-bromo-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)butane |
| SMILES | FC(F)(F)C(OCCCCBr)C(F)(F)F |
| InChI | InChI=1S/C7H9BrF6O/c8-3-1-2-4-15-5(6(9,10)11)7(12,13)14/h5H,1-4H2 |
| InChIKey | ZATLOIQNMHEOEE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.04 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|