C5HClF6N2OS — CID 102722062
3-chloro-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,2,5-thiadiazole (PubChem CID 102722062) has the molecular formula C5HClF6N2OS and a molecular weight of 286.58 g/mol. Its IUPAC name is 3-chloro-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,2,5-thiadiazole.
| Compound Name | 3-chloro-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 102722062 |
| Molecular Formula | C5HClF6N2OS |
| Molecular Weight | 286.58 g/mol |
| Exact Mass | 285.94 |
| IUPAC Name | 3-chloro-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,2,5-thiadiazole |
| SMILES | FC(F)(F)C(Oc1nsnc1Cl)C(F)(F)F |
| InChI | InChI=1S/C5HClF6N2OS/c6-1-2(14-16-13-1)15-3(4(7,8)9)5(10,11)12/h3H |
| InChIKey | OHXROOHBAGBBSC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.58 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |