C10H14F6N2O2S — CID 102722234
N-(3-amino-3-sulfanylidenepropyl)-3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-methylpropanamide (PubChem CID 102722234) has the molecular formula C10H14F6N2O2S and a molecular weight of 340.29 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-methylpropanamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-methylpropanamide |
|---|---|
| PubChem CID | 102722234 |
| Molecular Formula | C10H14F6N2O2S |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-methylpropanamide |
| SMILES | CN(CCC(N)=S)C(=O)CCOC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H14F6N2O2S/c1-18(4-2-6(17)21)7(19)3-5-20-8(9(11,12)13)10(14,15)16/h8H,2-5H2,1H3,(H2,17,21) |
| InChIKey | VDDKUHPDHZIPCE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|