C9H11F6N3O2 — CID 102722252
2-[5-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-1,2,4-oxadiazol-3-yl]propan-2-amine (PubChem CID 102722252) has the molecular formula C9H11F6N3O2 and a molecular weight of 307.19 g/mol. Its IUPAC name is 2-[5-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-1,2,4-oxadiazol-3-yl]propan-2-amine.
| Compound Name | 2-[5-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-1,2,4-oxadiazol-3-yl]propan-2-amine |
|---|---|
| PubChem CID | 102722252 |
| Molecular Formula | C9H11F6N3O2 |
| Molecular Weight | 307.19 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 2-[5-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-1,2,4-oxadiazol-3-yl]propan-2-amine |
| SMILES | CC(C)(N)c1noc(COC(C(F)(F)F)C(F)(F)F)n1 |
| InChI | InChI=1S/C9H11F6N3O2/c1-7(2,16)6-17-4(20-18-6)3-19-5(8(10,11)12)9(13,14)15/h5H,3,16H2,1-2H3 |
| InChIKey | GCQFXSCBPLQSIP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.19 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |