C10H16F6N2O2 — CID 102722304
5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N'-hydroxy-2,2-dimethylpentanimidamide (PubChem CID 102722304) has the molecular formula C10H16F6N2O2 and a molecular weight of 310.24 g/mol. Its IUPAC name is 5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N'-hydroxy-2,2-dimethylpentanimidamide.
| Compound Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N'-hydroxy-2,2-dimethylpentanimidamide |
|---|---|
| PubChem CID | 102722304 |
| Molecular Formula | C10H16F6N2O2 |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N'-hydroxy-2,2-dimethylpentanimidamide |
| SMILES | CC(C)(CCCOC(C(F)(F)F)C(F)(F)F)C(N)=NO |
| InChI | InChI=1S/C10H16F6N2O2/c1-8(2,7(17)18-19)4-3-5-20-6(9(11,12)13)10(14,15)16/h6,19H,3-5H2,1-2H3,(H2,17,18) |
| InChIKey | BSOQSWQYXSOYRR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|