C9H7F6N3O — CID 102722319
2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pyridine-4-carboximidamide (PubChem CID 102722319) has the molecular formula C9H7F6N3O and a molecular weight of 287.16 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pyridine-4-carboximidamide.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pyridine-4-carboximidamide |
|---|---|
| PubChem CID | 102722319 |
| Molecular Formula | C9H7F6N3O |
| Molecular Weight | 287.16 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pyridine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccnc(OC(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C9H7F6N3O/c10-8(11,12)7(9(13,14)15)19-5-3-4(6(16)17)1-2-18-5/h1-3,7H,(H3,16,17) |
| InChIKey | KEGTVTQPBWIKOQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 71.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.16 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|