C6H8F6N2O — CID 102722351
3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propanimidamide (PubChem CID 102722351) has the molecular formula C6H8F6N2O and a molecular weight of 238.13 g/mol. Its IUPAC name is 3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propanimidamide.
| Compound Name | 3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propanimidamide |
|---|---|
| PubChem CID | 102722351 |
| Molecular Formula | C6H8F6N2O |
| Molecular Weight | 238.13 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propanimidamide |
| SMILES | [H]/N=C(\N)CCOC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H8F6N2O/c7-5(8,9)4(6(10,11)12)15-2-1-3(13)14/h4H,1-2H2,(H3,13,14) |
| InChIKey | YDQKQHRSDNIHAS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.13 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|