C9H4Br2F6O2S — CID 102722490
1-(2,5-dibromothiophen-3-yl)-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethanone (PubChem CID 102722490) has the molecular formula C9H4Br2F6O2S and a molecular weight of 449.99 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethanone.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethanone |
|---|---|
| PubChem CID | 102722490 |
| Molecular Formula | C9H4Br2F6O2S |
| Molecular Weight | 449.99 g/mol |
| Exact Mass | 447.82 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethanone |
| SMILES | O=C(COC(C(F)(F)F)C(F)(F)F)c1cc(Br)sc1Br |
| InChI | InChI=1S/C9H4Br2F6O2S/c10-5-1-3(6(11)20-5)4(18)2-19-7(8(12,13)14)9(15,16)17/h1,7H,2H2 |
| InChIKey | NYHIFKFXPWYWBD-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.99 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |