C12H13F6NO2 — CID 102722501
2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1-(1,2,5-trimethylpyrrol-3-yl)ethanone (PubChem CID 102722501) has the molecular formula C12H13F6NO2 and a molecular weight of 317.23 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1-(1,2,5-trimethylpyrrol-3-yl)ethanone.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1-(1,2,5-trimethylpyrrol-3-yl)ethanone |
|---|---|
| PubChem CID | 102722501 |
| Molecular Formula | C12H13F6NO2 |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1-(1,2,5-trimethylpyrrol-3-yl)ethanone |
| SMILES | Cc1cc(C(=O)COC(C(F)(F)F)C(F)(F)F)c(C)n1C |
| InChI | InChI=1S/C12H13F6NO2/c1-6-4-8(7(2)19(6)3)9(20)5-21-10(11(13,14)15)12(16,17)18/h4,10H,5H2,1-3H3 |
| InChIKey | BHJQHNPOXOOWGS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |