C12H10F6O2S — CID 102722667
4-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)thiophen-3-yl]but-3-yn-1-ol (PubChem CID 102722667) has the molecular formula C12H10F6O2S and a molecular weight of 332.27 g/mol. Its IUPAC name is 4-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)thiophen-3-yl]but-3-yn-1-ol.
| Compound Name | 4-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)thiophen-3-yl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 102722667 |
| Molecular Formula | C12H10F6O2S |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 4-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)thiophen-3-yl]but-3-yn-1-ol |
| SMILES | OCCC#Cc1ccsc1COC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H10F6O2S/c13-11(14,15)10(12(16,17)18)20-7-9-8(4-6-21-9)3-1-2-5-19/h4,6,10,19H,2,5,7H2 |
| InChIKey | JXEKODSMAXOLON-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|