C11H8F6O2S — CID 102722672
3-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)thiophen-3-yl]prop-2-yn-1-ol (PubChem CID 102722672) has the molecular formula C11H8F6O2S and a molecular weight of 318.24 g/mol. Its IUPAC name is 3-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)thiophen-3-yl]prop-2-yn-1-ol.
| Compound Name | 3-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)thiophen-3-yl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 102722672 |
| Molecular Formula | C11H8F6O2S |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 3-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)thiophen-3-yl]prop-2-yn-1-ol |
| SMILES | OCC#Cc1ccsc1COC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H8F6O2S/c12-10(13,14)9(11(15,16)17)19-6-8-7(2-1-4-18)3-5-20-8/h3,5,9,18H,4,6H2 |
| InChIKey | CXFDWRNOYCANRT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|