C7H7F6IO3S — CID 102722943
3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-iodothiolane 1,1-dioxide (PubChem CID 102722943) has the molecular formula C7H7F6IO3S and a molecular weight of 412.09 g/mol. Its IUPAC name is 3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-iodothiolane 1,1-dioxide.
| Compound Name | 3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-iodothiolane 1,1-dioxide |
|---|---|
| PubChem CID | 102722943 |
| Molecular Formula | C7H7F6IO3S |
| Molecular Weight | 412.09 g/mol |
| Exact Mass | 411.91 |
| IUPAC Name | 3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-iodothiolane 1,1-dioxide |
| SMILES | O=S1(=O)CC(I)C(OC(C(F)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C7H7F6IO3S/c8-6(9,10)5(7(11,12)13)17-4-2-18(15,16)1-3(4)14/h3-5H,1-2H2 |
| InChIKey | SUOIUYNVRIZJQZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.09 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|