C12H10Br2F6O — CID 102722973
1-bromo-2-[1-bromo-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propan-2-yl]benzene (PubChem CID 102722973) has the molecular formula C12H10Br2F6O and a molecular weight of 444.01 g/mol. Its IUPAC name is 1-bromo-2-[1-bromo-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propan-2-yl]benzene.
| Compound Name | 1-bromo-2-[1-bromo-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propan-2-yl]benzene |
|---|---|
| PubChem CID | 102722973 |
| Molecular Formula | C12H10Br2F6O |
| Molecular Weight | 444.01 g/mol |
| Exact Mass | 441.90 |
| IUPAC Name | 1-bromo-2-[1-bromo-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propan-2-yl]benzene |
| SMILES | CC(CBr)(OC(C(F)(F)F)C(F)(F)F)c1ccccc1Br |
| InChI | InChI=1S/C12H10Br2F6O/c1-10(6-13,7-4-2-3-5-8(7)14)21-9(11(15,16)17)12(18,19)20/h2-5,9H,6H2,1H3 |
| InChIKey | SQGSUCAUCVXVPL-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.01 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|