C8H9F6N3OS — CID 102723138
N-[[5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,4-thiadiazol-2-yl]methyl]ethanamine (PubChem CID 102723138) has the molecular formula C8H9F6N3OS and a molecular weight of 309.24 g/mol. Its IUPAC name is N-[[5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,4-thiadiazol-2-yl]methyl]ethanamine.
| Compound Name | N-[[5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,4-thiadiazol-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 102723138 |
| Molecular Formula | C8H9F6N3OS |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | N-[[5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,4-thiadiazol-2-yl]methyl]ethanamine |
| SMILES | CCNCc1nnc(OC(C(F)(F)F)C(F)(F)F)s1 |
| InChI | InChI=1S/C8H9F6N3OS/c1-2-15-3-4-16-17-6(19-4)18-5(7(9,10)11)8(12,13)14/h5,15H,2-3H2,1H3 |
| InChIKey | QOMKNSIEJMKNMZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |